C11H6ClF3N2O2 — CID 115111366
3-[4-chloro-2-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid (PubChem CID 115111366) has the molecular formula C11H6ClF3N2O2 and a molecular weight of 290.63 g/mol. Its IUPAC name is 3-[4-chloro-2-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[4-chloro-2-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115111366 |
| Molecular Formula | C11H6ClF3N2O2 |
| Molecular Weight | 290.63 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 3-[4-chloro-2-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(Cl)cc2C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C11H6ClF3N2O2/c12-5-1-2-6(7(3-5)11(13,14)15)8-4-9(10(18)19)17-16-8/h1-4H,(H,16,17)(H,18,19) |
| InChIKey | NMNGRSFZPAFRLU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |