C14H9ClN2O3 — CID 136968351
3-(7-chloro-3-hydroxynaphthalen-2-yl)-1H-pyrazole-5-carboxylic acid (PubChem CID 136968351) has the molecular formula C14H9ClN2O3 and a molecular weight of 288.69 g/mol. Its IUPAC name is 3-(7-chloro-3-hydroxynaphthalen-2-yl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(7-chloro-3-hydroxynaphthalen-2-yl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136968351 |
| Molecular Formula | C14H9ClN2O3 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 3-(7-chloro-3-hydroxynaphthalen-2-yl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc3cc(Cl)ccc3cc2O)n[nH]1 |
| InChI | InChI=1S/C14H9ClN2O3/c15-9-2-1-7-5-13(18)10(4-8(7)3-9)11-6-12(14(19)20)17-16-11/h1-6,18H,(H,16,17)(H,19,20) |
| InChIKey | BFTSDZYPYIDLKW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |