3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid

C10H5ClF2N2O2 — CID 117400123

IUPAC3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid
SMILESO=C(O)c1cc(-c2c(F)cc(Cl)cc2F)n[nH]1
InChIInChI=1S/C10H5ClF2N2O2/c11-4-1-5(12)9(6(13)2-4)7-3-8(10(16)17)15-14-7/h1-3H,(H,14,15)(H,16,17)
InChIKeyTZPYEQGAKOVGSZ-UHFFFAOYSA-N
MW258.61 g/mol
LogP2.71
Rot. Bonds2

About 3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid

3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117400123) has the molecular formula C10H5ClF2N2O2 and a molecular weight of 258.61 g/mol. Its IUPAC name is 3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid
PubChem CID117400123
Molecular FormulaC10H5ClF2N2O2
Molecular Weight258.61 g/mol
Exact Mass258.00
IUPAC Name3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid
SMILESO=C(O)c1cc(-c2c(F)cc(Cl)cc2F)n[nH]1
InChIInChI=1S/C10H5ClF2N2O2/c11-4-1-5(12)9(6(13)2-4)7-3-8(10(16)17)15-14-7/h1-3H,(H,14,15)(H,16,17)
InChIKeyTZPYEQGAKOVGSZ-UHFFFAOYSA-N
XLogP2.71
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.61
LogP ≤ 52.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid (CID 117400123) is 3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid is O=C(O)c1cc(-c2c(F)cc(Cl)cc2F)n[nH]1.
What is the InChIKey of 3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid?
The InChIKey is TZPYEQGAKOVGSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClF2N2O2/c11-4-1-5(12)9(6(13)2-4)7-3-8(10(16)17)15-14-7/h1-3H,(H,14,15)(H,16,17).
What are the key properties of 3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid?
3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid has a molecular weight of 258.61 g/mol, XLogP of 2.71, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-2,6-difluorophenyl)-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 117400123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).