C10H6BrFN2O4 — CID 136995060
3-(6-bromo-2-fluoro-3,4-dihydroxyphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 136995060) has the molecular formula C10H6BrFN2O4 and a molecular weight of 317.07 g/mol. Its IUPAC name is 3-(6-bromo-2-fluoro-3,4-dihydroxyphenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(6-bromo-2-fluoro-3,4-dihydroxyphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 136995060 |
| Molecular Formula | C10H6BrFN2O4 |
| Molecular Weight | 317.07 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | 3-(6-bromo-2-fluoro-3,4-dihydroxyphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2c(Br)cc(O)c(O)c2F)n[nH]1 |
| InChI | InChI=1S/C10H6BrFN2O4/c11-3-1-6(15)9(16)8(12)7(3)4-2-5(10(17)18)14-13-4/h1-2,15-16H,(H,13,14)(H,17,18) |
| InChIKey | UKLMNIGJONYDJC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.07 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|