C10H4ClF3N2O2 — CID 117443210
3-(3-chloro-2,4,6-trifluorophenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117443210) has the molecular formula C10H4ClF3N2O2 and a molecular weight of 276.60 g/mol. Its IUPAC name is 3-(3-chloro-2,4,6-trifluorophenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(3-chloro-2,4,6-trifluorophenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117443210 |
| Molecular Formula | C10H4ClF3N2O2 |
| Molecular Weight | 276.60 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 3-(3-chloro-2,4,6-trifluorophenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2c(F)cc(F)c(Cl)c2F)n[nH]1 |
| InChI | InChI=1S/C10H4ClF3N2O2/c11-8-4(13)1-3(12)7(9(8)14)5-2-6(10(17)18)16-15-5/h1-2H,(H,15,16)(H,17,18) |
| InChIKey | KQVMDAHZMCFHAQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|