C10H4BrF3N2O2 — CID 115111378
3-(4-bromo-2,3,5-trifluorophenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 115111378) has the molecular formula C10H4BrF3N2O2 and a molecular weight of 321.05 g/mol. Its IUPAC name is 3-(4-bromo-2,3,5-trifluorophenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(4-bromo-2,3,5-trifluorophenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115111378 |
| Molecular Formula | C10H4BrF3N2O2 |
| Molecular Weight | 321.05 g/mol |
| Exact Mass | 319.94 |
| IUPAC Name | 3-(4-bromo-2,3,5-trifluorophenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(F)c(Br)c(F)c2F)n[nH]1 |
| InChI | InChI=1S/C10H4BrF3N2O2/c11-7-4(12)1-3(8(13)9(7)14)5-2-6(10(17)18)16-15-5/h1-2H,(H,15,16)(H,17,18) |
| InChIKey | CSUCZODSXOJRTN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.05 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|