C12H10BrFN2O2 — CID 117498031
3-(3-bromo-5-ethyl-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117498031) has the molecular formula C12H10BrFN2O2 and a molecular weight of 313.13 g/mol. Its IUPAC name is 3-(3-bromo-5-ethyl-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(3-bromo-5-ethyl-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117498031 |
| Molecular Formula | C12H10BrFN2O2 |
| Molecular Weight | 313.13 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 3-(3-bromo-5-ethyl-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | CCc1cc(Br)c(F)c(-c2cc(C(=O)O)[nH]n2)c1 |
| InChI | InChI=1S/C12H10BrFN2O2/c1-2-6-3-7(11(14)8(13)4-6)9-5-10(12(17)18)16-15-9/h3-5H,2H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | SLJMJRAXXAJAPT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.13 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |