C11H6F2N2O4 — CID 117423812
3-(4-carboxy-2,3-difluorophenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117423812) has the molecular formula C11H6F2N2O4 and a molecular weight of 268.18 g/mol. Its IUPAC name is 3-(4-carboxy-2,3-difluorophenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(4-carboxy-2,3-difluorophenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117423812 |
| Molecular Formula | C11H6F2N2O4 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 3-(4-carboxy-2,3-difluorophenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C(=O)O)c(F)c2F)n[nH]1 |
| InChI | InChI=1S/C11H6F2N2O4/c12-8-4(1-2-5(9(8)13)10(16)17)6-3-7(11(18)19)15-14-6/h1-3H,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | DJJGRTSDFIHOGY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |