3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid

C10H5Cl2FN2O2 — CID 117439401

IUPAC3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid
SMILESO=C(O)c1cc(-c2c(Cl)ccc(Cl)c2F)n[nH]1
InChIInChI=1S/C10H5Cl2FN2O2/c11-4-1-2-5(12)9(13)8(4)6-3-7(10(16)17)15-14-6/h1-3H,(H,14,15)(H,16,17)
InChIKeyLUPHSIQAPOWWKM-UHFFFAOYSA-N
MW275.07 g/mol
LogP3.22
Rot. Bonds2

About 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid

3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117439401) has the molecular formula C10H5Cl2FN2O2 and a molecular weight of 275.07 g/mol. Its IUPAC name is 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid
PubChem CID117439401
Molecular FormulaC10H5Cl2FN2O2
Molecular Weight275.07 g/mol
Exact Mass273.97
IUPAC Name3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid
SMILESO=C(O)c1cc(-c2c(Cl)ccc(Cl)c2F)n[nH]1
InChIInChI=1S/C10H5Cl2FN2O2/c11-4-1-2-5(12)9(13)8(4)6-3-7(10(16)17)15-14-6/h1-3H,(H,14,15)(H,16,17)
InChIKeyLUPHSIQAPOWWKM-UHFFFAOYSA-N
XLogP3.22
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.07
LogP ≤ 53.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid (CID 117439401) is 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid is O=C(O)c1cc(-c2c(Cl)ccc(Cl)c2F)n[nH]1.
What is the InChIKey of 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid?
The InChIKey is LUPHSIQAPOWWKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl2FN2O2/c11-4-1-2-5(12)9(13)8(4)6-3-7(10(16)17)15-14-6/h1-3H,(H,14,15)(H,16,17).
What are the key properties of 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid?
3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid has a molecular weight of 275.07 g/mol, XLogP of 3.22, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 117439401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).