C10H5Cl2FN2O2 — CID 117439401
3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117439401) has the molecular formula C10H5Cl2FN2O2 and a molecular weight of 275.07 g/mol. Its IUPAC name is 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117439401 |
| Molecular Formula | C10H5Cl2FN2O2 |
| Molecular Weight | 275.07 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 3-(3,6-dichloro-2-fluorophenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2c(Cl)ccc(Cl)c2F)n[nH]1 |
| InChI | InChI=1S/C10H5Cl2FN2O2/c11-4-1-2-5(12)9(13)8(4)6-3-7(10(16)17)15-14-6/h1-3H,(H,14,15)(H,16,17) |
| InChIKey | LUPHSIQAPOWWKM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.07 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|