C12H11FN2O4 — CID 117419215
3-(2-fluoro-3,6-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117419215) has the molecular formula C12H11FN2O4 and a molecular weight of 266.23 g/mol. Its IUPAC name is 3-(2-fluoro-3,6-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(2-fluoro-3,6-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117419215 |
| Molecular Formula | C12H11FN2O4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-(2-fluoro-3,6-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)O)[nH]n2)c1F |
| InChI | InChI=1S/C12H11FN2O4/c1-18-8-3-4-9(19-2)11(13)10(8)6-5-7(12(16)17)15-14-6/h3-5H,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | CTNFVZCFYAOFQP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |