C12H10F2N2O4 — CID 117457469
3-(2,3-difluoro-5,6-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117457469) has the molecular formula C12H10F2N2O4 and a molecular weight of 284.22 g/mol. Its IUPAC name is 3-(2,3-difluoro-5,6-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(2,3-difluoro-5,6-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117457469 |
| Molecular Formula | C12H10F2N2O4 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-(2,3-difluoro-5,6-dimethoxyphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | COc1cc(F)c(F)c(-c2cc(C(=O)O)[nH]n2)c1OC |
| InChI | InChI=1S/C12H10F2N2O4/c1-19-8-3-5(13)10(14)9(11(8)20-2)6-4-7(12(17)18)16-15-6/h3-4H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | ABTFMGUISMHVAI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |