C11H9ClN2O3 — CID 117384630
3-(2-chloro-3-hydroxy-4-methylphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117384630) has the molecular formula C11H9ClN2O3 and a molecular weight of 252.66 g/mol. Its IUPAC name is 3-(2-chloro-3-hydroxy-4-methylphenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(2-chloro-3-hydroxy-4-methylphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117384630 |
| Molecular Formula | C11H9ClN2O3 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 3-(2-chloro-3-hydroxy-4-methylphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(C(=O)O)[nH]n2)c(Cl)c1O |
| InChI | InChI=1S/C11H9ClN2O3/c1-5-2-3-6(9(12)10(5)15)7-4-8(11(16)17)14-13-7/h2-4,15H,1H3,(H,13,14)(H,16,17) |
| InChIKey | WCJZWEUPNVBLLL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |