C13H12N2O4 — CID 117404379
3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117404379) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117404379 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)cc(-c2cc(C(=O)O)[nH]n2)c1C |
| InChI | InChI=1S/C13H12N2O4/c1-6-3-8(12(16)17)4-9(7(6)2)10-5-11(13(18)19)15-14-10/h3-5H,1-2H3,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | LTXHFMQJRRNLEG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |