3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid

C13H12N2O4 — CID 117404379

IUPAC3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid
SMILESCc1cc(C(=O)O)cc(-c2cc(C(=O)O)[nH]n2)c1C
InChIInChI=1S/C13H12N2O4/c1-6-3-8(12(16)17)4-9(7(6)2)10-5-11(13(18)19)15-14-10/h3-5H,1-2H3,(H,14,15)(H,16,17)(H,18,19)
InChIKeyLTXHFMQJRRNLEG-UHFFFAOYSA-N
MW260.25 g/mol
LogP2.09
Rot. Bonds3

About 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid

3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117404379) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid
PubChem CID117404379
Molecular FormulaC13H12N2O4
Molecular Weight260.25 g/mol
Exact Mass260.08
IUPAC Name3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid
SMILESCc1cc(C(=O)O)cc(-c2cc(C(=O)O)[nH]n2)c1C
InChIInChI=1S/C13H12N2O4/c1-6-3-8(12(16)17)4-9(7(6)2)10-5-11(13(18)19)15-14-10/h3-5H,1-2H3,(H,14,15)(H,16,17)(H,18,19)
InChIKeyLTXHFMQJRRNLEG-UHFFFAOYSA-N
XLogP2.09
TPSA103.28 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.25
LogP ≤ 52.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid (CID 117404379) is 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid is Cc1cc(C(=O)O)cc(-c2cc(C(=O)O)[nH]n2)c1C.
What is the InChIKey of 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
The InChIKey is LTXHFMQJRRNLEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O4/c1-6-3-8(12(16)17)4-9(7(6)2)10-5-11(13(18)19)15-14-10/h3-5H,1-2H3,(H,14,15)(H,16,17)(H,18,19).
What are the key properties of 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid has a molecular weight of 260.25 g/mol, XLogP of 2.09, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-carboxy-2,3-dimethylphenyl)-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 117404379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).