C13H10ClN3O2 — CID 117441324
3-(4-chloro-2-methyl-1H-indol-5-yl)-1H-pyrazole-5-carboxylic acid (PubChem CID 117441324) has the molecular formula C13H10ClN3O2 and a molecular weight of 275.70 g/mol. Its IUPAC name is 3-(4-chloro-2-methyl-1H-indol-5-yl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-(4-chloro-2-methyl-1H-indol-5-yl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117441324 |
| Molecular Formula | C13H10ClN3O2 |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 3-(4-chloro-2-methyl-1H-indol-5-yl)-1H-pyrazole-5-carboxylic acid |
| SMILES | Cc1cc2c(Cl)c(-c3cc(C(=O)O)[nH]n3)ccc2[nH]1 |
| InChI | InChI=1S/C13H10ClN3O2/c1-6-4-8-9(15-6)3-2-7(12(8)14)10-5-11(13(18)19)17-16-10/h2-5,15H,1H3,(H,16,17)(H,18,19) |
| InChIKey | XLVLKQWXFCHUJQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |