C13H12F3N3O2 — CID 115111374
3-[5-(dimethylamino)-2-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid (PubChem CID 115111374) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 3-[5-(dimethylamino)-2-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[5-(dimethylamino)-2-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115111374 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-[5-(dimethylamino)-2-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid |
| SMILES | CN(C)c1ccc(C(F)(F)F)c(-c2cc(C(=O)O)[nH]n2)c1 |
| InChI | InChI=1S/C13H12F3N3O2/c1-19(2)7-3-4-9(13(14,15)16)8(5-7)10-6-11(12(20)21)18-17-10/h3-6H,1-2H3,(H,17,18)(H,20,21) |
| InChIKey | SCFOPKRAAKYARM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |