C14H8Cl2F3NO2 — CID 142574205
3-chloro-6-[2-chloro-6-methyl-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid (PubChem CID 142574205) has the molecular formula C14H8Cl2F3NO2 and a molecular weight of 350.12 g/mol. Its IUPAC name is 3-chloro-6-[2-chloro-6-methyl-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid.
| Compound Name | 3-chloro-6-[2-chloro-6-methyl-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 142574205 |
| Molecular Formula | C14H8Cl2F3NO2 |
| Molecular Weight | 350.12 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 3-chloro-6-[2-chloro-6-methyl-4-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid |
| SMILES | Cc1cc(C(F)(F)F)cc(Cl)c1-c1ccc(Cl)c(C(=O)O)n1 |
| InChI | InChI=1S/C14H8Cl2F3NO2/c1-6-4-7(14(17,18)19)5-9(16)11(6)10-3-2-8(15)12(20-10)13(21)22/h2-5H,1H3,(H,21,22) |
| InChIKey | SRHNKIHLDCEGEU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.12 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |