C12H5Cl2F2NO2 — CID 142574457
3-chloro-6-(4-chloro-2,3-difluorophenyl)pyridine-2-carboxylic acid (PubChem CID 142574457) has the molecular formula C12H5Cl2F2NO2 and a molecular weight of 304.08 g/mol. Its IUPAC name is 3-chloro-6-(4-chloro-2,3-difluorophenyl)pyridine-2-carboxylic acid.
| Compound Name | 3-chloro-6-(4-chloro-2,3-difluorophenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 142574457 |
| Molecular Formula | C12H5Cl2F2NO2 |
| Molecular Weight | 304.08 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 3-chloro-6-(4-chloro-2,3-difluorophenyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccc(Cl)c(F)c2F)ccc1Cl |
| InChI | InChI=1S/C12H5Cl2F2NO2/c13-6-2-1-5(9(15)10(6)16)8-4-3-7(14)11(17-8)12(18)19/h1-4H,(H,18,19) |
| InChIKey | OCBXIGJSMKMWQC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.08 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|