C17H17ClF2N2O3Si — CID 141417503
4-acetamido-3-chloro-6-(2,3-difluoro-4-trimethylsilylphenyl)pyridine-2-carboxylic acid (PubChem CID 141417503) has the molecular formula C17H17ClF2N2O3Si and a molecular weight of 398.87 g/mol. Its IUPAC name is 4-acetamido-3-chloro-6-(2,3-difluoro-4-trimethylsilylphenyl)pyridine-2-carboxylic acid.
| Compound Name | 4-acetamido-3-chloro-6-(2,3-difluoro-4-trimethylsilylphenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 141417503 |
| Molecular Formula | C17H17ClF2N2O3Si |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 4-acetamido-3-chloro-6-(2,3-difluoro-4-trimethylsilylphenyl)pyridine-2-carboxylic acid |
| SMILES | CC(=O)Nc1cc(-c2ccc([Si](C)(C)C)c(F)c2F)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C17H17ClF2N2O3Si/c1-8(23)21-11-7-10(22-16(13(11)18)17(24)25)9-5-6-12(26(2,3)4)15(20)14(9)19/h5-7H,1-4H3,(H,24,25)(H,21,22,23) |
| InChIKey | VTAGEPISFOBCRB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|