C16H13Cl2FN2O4 — CID 68600593
methyl 4-acetamido-3-chloro-6-(4-chloro-2-fluoro-5-methoxyphenyl)pyridine-2-carboxylate (PubChem CID 68600593) has the molecular formula C16H13Cl2FN2O4 and a molecular weight of 387.19 g/mol. Its IUPAC name is methyl 4-acetamido-3-chloro-6-(4-chloro-2-fluoro-5-methoxyphenyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-acetamido-3-chloro-6-(4-chloro-2-fluoro-5-methoxyphenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 68600593 |
| Molecular Formula | C16H13Cl2FN2O4 |
| Molecular Weight | 387.19 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | methyl 4-acetamido-3-chloro-6-(4-chloro-2-fluoro-5-methoxyphenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2cc(OC)c(Cl)cc2F)cc(NC(C)=O)c1Cl |
| InChI | InChI=1S/C16H13Cl2FN2O4/c1-7(22)20-12-6-11(21-15(14(12)18)16(23)25-3)8-4-13(24-2)9(17)5-10(8)19/h4-6H,1-3H3,(H,20,21,22) |
| InChIKey | HULKZLXANIICHZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |