C10H11ClN2O3 — CID 123968717
methyl 4-acetamido-3-chloro-6-methylpyridine-2-carboxylate (PubChem CID 123968717) has the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. Its IUPAC name is methyl 4-acetamido-3-chloro-6-methylpyridine-2-carboxylate.
| Compound Name | methyl 4-acetamido-3-chloro-6-methylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 123968717 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | methyl 4-acetamido-3-chloro-6-methylpyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(C)cc(NC(C)=O)c1Cl |
| InChI | InChI=1S/C10H11ClN2O3/c1-5-4-7(13-6(2)14)8(11)9(12-5)10(15)16-3/h4H,1-3H3,(H,12,13,14) |
| InChIKey | ILFXNBXLCKSSTN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |