methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate

C8H8BrNO3 — CID 142367193

IUPACmethyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate
SMILESCOC(=O)c1nc(C)cc(Br)c1O
InChIInChI=1S/C8H8BrNO3/c1-4-3-5(9)7(11)6(10-4)8(12)13-2/h3,11H,1-2H3
InChIKeyPBMSZWSFGHTIFN-UHFFFAOYSA-N
MW246.06 g/mol
LogP1.64
Rot. Bonds1

About methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate

methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate (PubChem CID 142367193) has the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. Its IUPAC name is methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate
PubChem CID142367193
Molecular FormulaC8H8BrNO3
Molecular Weight246.06 g/mol
Exact Mass244.97
IUPAC Namemethyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate
SMILESCOC(=O)c1nc(C)cc(Br)c1O
InChIInChI=1S/C8H8BrNO3/c1-4-3-5(9)7(11)6(10-4)8(12)13-2/h3,11H,1-2H3
InChIKeyPBMSZWSFGHTIFN-UHFFFAOYSA-N
XLogP1.64
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.06
LogP ≤ 51.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate?
The IUPAC name of methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate (CID 142367193) is methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate.
What is the SMILES notation for methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate?
The canonical SMILES for methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate is COC(=O)c1nc(C)cc(Br)c1O.
What is the InChIKey of methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate?
The InChIKey is PBMSZWSFGHTIFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO3/c1-4-3-5(9)7(11)6(10-4)8(12)13-2/h3,11H,1-2H3.
What are the key properties of methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate?
methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate has a molecular weight of 246.06 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-3-hydroxy-6-methylpyridine-2-carboxylate is sourced from PubChem (CID 142367193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).