C8H11N3O2 — CID 66284805
methyl 4-methyl-6-(methylamino)pyrimidine-2-carboxylate (PubChem CID 66284805) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is methyl 4-methyl-6-(methylamino)pyrimidine-2-carboxylate.
| Compound Name | methyl 4-methyl-6-(methylamino)pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 66284805 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | methyl 4-methyl-6-(methylamino)pyrimidine-2-carboxylate |
| SMILES | CNc1cc(C)nc(C(=O)OC)n1 |
| InChI | InChI=1S/C8H11N3O2/c1-5-4-6(9-2)11-7(10-5)8(12)13-3/h4H,1-3H3,(H,9,10,11) |
| InChIKey | VLXGECGZOHOYGH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |