C10H16N4O2 — CID 66284897
methyl 4-methyl-6-[2-(methylamino)ethylamino]pyrimidine-2-carboxylate (PubChem CID 66284897) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl 4-methyl-6-[2-(methylamino)ethylamino]pyrimidine-2-carboxylate.
| Compound Name | methyl 4-methyl-6-[2-(methylamino)ethylamino]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 66284897 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | methyl 4-methyl-6-[2-(methylamino)ethylamino]pyrimidine-2-carboxylate |
| SMILES | CNCCNc1cc(C)nc(C(=O)OC)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-7-6-8(12-5-4-11-2)14-9(13-7)10(15)16-3/h6,11H,4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | YPSFYHOITADSSZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|