C13H15N3O3 — CID 66284656
methyl 4-methyl-6-[(5-methylfuran-2-yl)methylamino]pyrimidine-2-carboxylate (PubChem CID 66284656) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is methyl 4-methyl-6-[(5-methylfuran-2-yl)methylamino]pyrimidine-2-carboxylate.
| Compound Name | methyl 4-methyl-6-[(5-methylfuran-2-yl)methylamino]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 66284656 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | methyl 4-methyl-6-[(5-methylfuran-2-yl)methylamino]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc(C)cc(NCc2ccc(C)o2)n1 |
| InChI | InChI=1S/C13H15N3O3/c1-8-6-11(16-12(15-8)13(17)18-3)14-7-10-5-4-9(2)19-10/h4-6H,7H2,1-3H3,(H,14,15,16) |
| InChIKey | GVWFDLBMYORSOP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |