C9H13N3O3 — CID 66285824
methyl 4-(2-hydroxyethylamino)-6-methylpyrimidine-2-carboxylate (PubChem CID 66285824) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl 4-(2-hydroxyethylamino)-6-methylpyrimidine-2-carboxylate.
| Compound Name | methyl 4-(2-hydroxyethylamino)-6-methylpyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 66285824 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | methyl 4-(2-hydroxyethylamino)-6-methylpyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc(C)cc(NCCO)n1 |
| InChI | InChI=1S/C9H13N3O3/c1-6-5-7(10-3-4-13)12-8(11-6)9(14)15-2/h5,13H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | BJPXNBQMBZVTMN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |