C10H10N2O2 — CID 130298670
methyl 3-cyano-4,6-dimethylpyridine-2-carboxylate (PubChem CID 130298670) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is methyl 3-cyano-4,6-dimethylpyridine-2-carboxylate.
| Compound Name | methyl 3-cyano-4,6-dimethylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 130298670 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | methyl 3-cyano-4,6-dimethylpyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(C)cc(C)c1C#N |
| InChI | InChI=1S/C10H10N2O2/c1-6-4-7(2)12-9(8(6)5-11)10(13)14-3/h4H,1-3H3 |
| InChIKey | XCMMSTIMEUFUPZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |