C16H14N2O2 — CID 7573946
(3-cyano-4,6-dimethyl-2-pyridinyl) 4-methylbenzoate (PubChem CID 7573946) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is (3-cyano-4,6-dimethyl-2-pyridinyl) 4-methylbenzoate.
| Compound Name | (3-cyano-4,6-dimethyl-2-pyridinyl) 4-methylbenzoate |
|---|---|
| PubChem CID | 7573946 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (3-cyano-4,6-dimethyl-2-pyridinyl) 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2nc(C)cc(C)c2C#N)cc1 |
| InChI | InChI=1S/C16H14N2O2/c1-10-4-6-13(7-5-10)16(19)20-15-14(9-17)11(2)8-12(3)18-15/h4-8H,1-3H3 |
| InChIKey | UGGXGFIHVQNDAR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |