C17H15NO2 — CID 129452062
(4-cyano-2,6-dimethylphenyl) 4-methylbenzoate (PubChem CID 129452062) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is (4-cyano-2,6-dimethylphenyl) 4-methylbenzoate.
| Compound Name | (4-cyano-2,6-dimethylphenyl) 4-methylbenzoate |
|---|---|
| PubChem CID | 129452062 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (4-cyano-2,6-dimethylphenyl) 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2c(C)cc(C#N)cc2C)cc1 |
| InChI | InChI=1S/C17H15NO2/c1-11-4-6-15(7-5-11)17(19)20-16-12(2)8-14(10-18)9-13(16)3/h4-9H,1-3H3 |
| InChIKey | SJFLZDSWKDIYMB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|