C19H17NO3 — CID 71484702
(6-acetyl-2-cyano-3,4-dimethylphenyl) 4-methylbenzoate (PubChem CID 71484702) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (6-acetyl-2-cyano-3,4-dimethylphenyl) 4-methylbenzoate.
| Compound Name | (6-acetyl-2-cyano-3,4-dimethylphenyl) 4-methylbenzoate |
|---|---|
| PubChem CID | 71484702 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (6-acetyl-2-cyano-3,4-dimethylphenyl) 4-methylbenzoate |
| SMILES | CC(=O)c1cc(C)c(C)c(C#N)c1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H17NO3/c1-11-5-7-15(8-6-11)19(22)23-18-16(14(4)21)9-12(2)13(3)17(18)10-20/h5-9H,1-4H3 |
| InChIKey | JRSWRPBAHTUFQR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|