C13H11Cl3N2O2 — CID 71325366
N-(6-acetyl-2-cyano-3,4-dimethylphenyl)-2,2,2-trichloroacetamide (PubChem CID 71325366) has the molecular formula C13H11Cl3N2O2 and a molecular weight of 333.60 g/mol. Its IUPAC name is N-(6-acetyl-2-cyano-3,4-dimethylphenyl)-2,2,2-trichloroacetamide.
| Compound Name | N-(6-acetyl-2-cyano-3,4-dimethylphenyl)-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 71325366 |
| Molecular Formula | C13H11Cl3N2O2 |
| Molecular Weight | 333.60 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | N-(6-acetyl-2-cyano-3,4-dimethylphenyl)-2,2,2-trichloroacetamide |
| SMILES | CC(=O)c1cc(C)c(C)c(C#N)c1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H11Cl3N2O2/c1-6-4-9(8(3)19)11(10(5-17)7(6)2)18-12(20)13(14,15)16/h4H,1-3H3,(H,18,20) |
| InChIKey | WVTPJHNTWSRUIZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|