C24H19N3O2 — CID 11428974
methyl 4-[3-amino-2,4-dicyano-6-methyl-5-(4-methylphenyl)phenyl]benzoate (PubChem CID 11428974) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is methyl 4-[3-amino-2,4-dicyano-6-methyl-5-(4-methylphenyl)phenyl]benzoate.
| Compound Name | methyl 4-[3-amino-2,4-dicyano-6-methyl-5-(4-methylphenyl)phenyl]benzoate |
|---|---|
| PubChem CID | 11428974 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | methyl 4-[3-amino-2,4-dicyano-6-methyl-5-(4-methylphenyl)phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c(C)c(-c3ccc(C)cc3)c(C#N)c(N)c2C#N)cc1 |
| InChI | InChI=1S/C24H19N3O2/c1-14-4-6-16(7-5-14)21-15(2)22(20(13-26)23(27)19(21)12-25)17-8-10-18(11-9-17)24(28)29-3/h4-11H,27H2,1-3H3 |
| InChIKey | NPMHOJZTHOXZBS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|