C22H19N3O2 — CID 3470406
methyl 4-[2-amino-3-cyano-6-(2,4-dimethylphenyl)-4-pyridinyl]benzoate (PubChem CID 3470406) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is methyl 4-[2-amino-3-cyano-6-(2,4-dimethylphenyl)-4-pyridinyl]benzoate.
| Compound Name | methyl 4-[2-amino-3-cyano-6-(2,4-dimethylphenyl)-4-pyridinyl]benzoate |
|---|---|
| PubChem CID | 3470406 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | methyl 4-[2-amino-3-cyano-6-(2,4-dimethylphenyl)-4-pyridinyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(-c3ccc(C)cc3C)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C22H19N3O2/c1-13-4-9-17(14(2)10-13)20-11-18(19(12-23)21(24)25-20)15-5-7-16(8-6-15)22(26)27-3/h4-11H,1-3H3,(H2,24,25) |
| InChIKey | UGIAYGACEJIOCN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |