C22H21N3 — CID 3513608
2-amino-4,6-bis(2,5-dimethylphenyl)pyridine-3-carbonitrile (PubChem CID 3513608) has the molecular formula C22H21N3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-amino-4,6-bis(2,5-dimethylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4,6-bis(2,5-dimethylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3513608 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-amino-4,6-bis(2,5-dimethylphenyl)pyridine-3-carbonitrile |
| SMILES | Cc1ccc(C)c(-c2cc(-c3cc(C)ccc3C)c(C#N)c(N)n2)c1 |
| InChI | InChI=1S/C22H21N3/c1-13-5-7-15(3)17(9-13)19-11-21(25-22(24)20(19)12-23)18-10-14(2)6-8-16(18)4/h5-11H,1-4H3,(H2,24,25) |
| InChIKey | ICMGUXRVMICQPC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |