About 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile
2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile (PubChem CID 5118538) has the molecular formula C20H16FN3
and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile |
| PubChem CID | 5118538 |
| Molecular Formula | C20H16FN3 |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile |
| SMILES | Cc1ccc(C)c(-c2cc(-c3cccc(F)c3)nc(N)c2C#N)c1 |
| InChI | InChI=1S/C20H16FN3/c1-12-6-7-13(2)16(8-12)17-10-19(24-20(23)18(17)11-22)14-4-3-5-15(21)9-14/h3-10H,1-2H3,(H2,23,24) |
| InChIKey | LDHSEJZTAUNLTK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile?
The IUPAC name of 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile (CID 5118538) is 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile.
What is the SMILES notation for 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile?
The canonical SMILES for 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile is Cc1ccc(C)c(-c2cc(-c3cccc(F)c3)nc(N)c2C#N)c1.
What is the InChIKey of 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile?
The InChIKey is LDHSEJZTAUNLTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FN3/c1-12-6-7-13(2)16(8-12)17-10-19(24-20(23)18(17)11-22)14-4-3-5-15(21)9-14/h3-10H,1-2H3,(H2,23,24).
What are the key properties of 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile?
2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile has a molecular weight of 317.37 g/mol, XLogP of 4.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(2,5-dimethylphenyl)-6-(3-fluorophenyl)pyridine-3-carbonitrile is sourced from PubChem (CID 5118538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).