C19H14FN3 — CID 5118241
2-amino-6-(3-fluorophenyl)-4-(4-methylphenyl)pyridine-3-carbonitrile (PubChem CID 5118241) has the molecular formula C19H14FN3 and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-amino-6-(3-fluorophenyl)-4-(4-methylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(3-fluorophenyl)-4-(4-methylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5118241 |
| Molecular Formula | C19H14FN3 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-amino-6-(3-fluorophenyl)-4-(4-methylphenyl)pyridine-3-carbonitrile |
| SMILES | Cc1ccc(-c2cc(-c3cccc(F)c3)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C19H14FN3/c1-12-5-7-13(8-6-12)16-10-18(23-19(22)17(16)11-21)14-3-2-4-15(20)9-14/h2-10H,1H3,(H2,22,23) |
| InChIKey | WLLZZNFRQMOORU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |