C13H10FN3 — CID 4632780
2-amino-4-(3-fluorophenyl)-6-methylpyridine-3-carbonitrile (PubChem CID 4632780) has the molecular formula C13H10FN3 and a molecular weight of 227.24 g/mol. Its IUPAC name is 2-amino-4-(3-fluorophenyl)-6-methylpyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(3-fluorophenyl)-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4632780 |
| Molecular Formula | C13H10FN3 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-amino-4-(3-fluorophenyl)-6-methylpyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2cccc(F)c2)c(C#N)c(N)n1 |
| InChI | InChI=1S/C13H10FN3/c1-8-5-11(12(7-15)13(16)17-8)9-3-2-4-10(14)6-9/h2-6H,1H3,(H2,16,17) |
| InChIKey | RPERVENIHBOGHU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |