C20H14N4O4 — CID 5229288
methyl 4-[2-amino-3-cyano-6-(2-nitrophenyl)-4-pyridinyl]benzoate (PubChem CID 5229288) has the molecular formula C20H14N4O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is methyl 4-[2-amino-3-cyano-6-(2-nitrophenyl)-4-pyridinyl]benzoate.
| Compound Name | methyl 4-[2-amino-3-cyano-6-(2-nitrophenyl)-4-pyridinyl]benzoate |
|---|---|
| PubChem CID | 5229288 |
| Molecular Formula | C20H14N4O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | methyl 4-[2-amino-3-cyano-6-(2-nitrophenyl)-4-pyridinyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(-c3ccccc3[N+](=O)[O-])nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C20H14N4O4/c1-28-20(25)13-8-6-12(7-9-13)15-10-17(23-19(22)16(15)11-21)14-4-2-3-5-18(14)24(26)27/h2-10H,1H3,(H2,22,23) |
| InChIKey | XBJUIQAIWSNMMI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|