C19H13BrN4O3 — CID 5229295
2-amino-4-(3-bromo-4-methoxyphenyl)-6-(2-nitrophenyl)pyridine-3-carbonitrile (PubChem CID 5229295) has the molecular formula C19H13BrN4O3 and a molecular weight of 425.24 g/mol. Its IUPAC name is 2-amino-4-(3-bromo-4-methoxyphenyl)-6-(2-nitrophenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(3-bromo-4-methoxyphenyl)-6-(2-nitrophenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5229295 |
| Molecular Formula | C19H13BrN4O3 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 2-amino-4-(3-bromo-4-methoxyphenyl)-6-(2-nitrophenyl)pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3ccccc3[N+](=O)[O-])nc(N)c2C#N)cc1Br |
| InChI | InChI=1S/C19H13BrN4O3/c1-27-18-7-6-11(8-15(18)20)13-9-16(23-19(22)14(13)10-21)12-4-2-3-5-17(12)24(25)26/h2-9H,1H3,(H2,22,23) |
| InChIKey | FWILMWADIMSCFM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|