C20H13N5O2 — CID 10594341
2-amino-4-(1H-indol-3-yl)-6-(2-nitrophenyl)pyridine-3-carbonitrile (PubChem CID 10594341) has the molecular formula C20H13N5O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-amino-4-(1H-indol-3-yl)-6-(2-nitrophenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(1H-indol-3-yl)-6-(2-nitrophenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 10594341 |
| Molecular Formula | C20H13N5O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-amino-4-(1H-indol-3-yl)-6-(2-nitrophenyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2c[nH]c3ccccc23)cc(-c2ccccc2[N+](=O)[O-])nc1N |
| InChI | InChI=1S/C20H13N5O2/c21-10-15-14(16-11-23-17-7-3-1-5-12(16)17)9-18(24-20(15)22)13-6-2-4-8-19(13)25(26)27/h1-9,11,23H,(H2,22,24) |
| InChIKey | IFNPGSAEKCBZDS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|