C23H15N7O3S — CID 134159488
3,6-diamino-5-cyano-4-(1H-indol-3-yl)-N-(4-nitrophenyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 134159488) has the molecular formula C23H15N7O3S and a molecular weight of 469.49 g/mol. Its IUPAC name is 3,6-diamino-5-cyano-4-(1H-indol-3-yl)-N-(4-nitrophenyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3,6-diamino-5-cyano-4-(1H-indol-3-yl)-N-(4-nitrophenyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134159488 |
| Molecular Formula | C23H15N7O3S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 3,6-diamino-5-cyano-4-(1H-indol-3-yl)-N-(4-nitrophenyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | N#Cc1c(N)nc2sc(C(=O)Nc3ccc([N+](=O)[O-])cc3)c(N)c2c1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H15N7O3S/c24-9-14-17(15-10-27-16-4-2-1-3-13(15)16)18-19(25)20(34-23(18)29-21(14)26)22(31)28-11-5-7-12(8-6-11)30(32)33/h1-8,10,27H,25H2,(H2,26,29)(H,28,31) |
| InChIKey | QJEVXUQENBBVNX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 176.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|