C26H18N4O3S — CID 3120416
3-amino-N-(3-nitrophenyl)-4,6-diphenylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 3120416) has the molecular formula C26H18N4O3S and a molecular weight of 466.52 g/mol. Its IUPAC name is 3-amino-N-(3-nitrophenyl)-4,6-diphenylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(3-nitrophenyl)-4,6-diphenylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 3120416 |
| Molecular Formula | C26H18N4O3S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 3-amino-N-(3-nitrophenyl)-4,6-diphenylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Nc1c(C(=O)Nc2cccc([N+](=O)[O-])c2)sc2nc(-c3ccccc3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C26H18N4O3S/c27-23-22-20(16-8-3-1-4-9-16)15-21(17-10-5-2-6-11-17)29-26(22)34-24(23)25(31)28-18-12-7-13-19(14-18)30(32)33/h1-15H,27H2,(H,28,31) |
| InChIKey | TZZJVZPBUFFLBM-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|