C16H12F2N4O3S — CID 19581270
3-amino-6-(difluoromethyl)-4-methyl-N-(3-nitrophenyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19581270) has the molecular formula C16H12F2N4O3S and a molecular weight of 378.36 g/mol. Its IUPAC name is 3-amino-6-(difluoromethyl)-4-methyl-N-(3-nitrophenyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-6-(difluoromethyl)-4-methyl-N-(3-nitrophenyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19581270 |
| Molecular Formula | C16H12F2N4O3S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 3-amino-6-(difluoromethyl)-4-methyl-N-(3-nitrophenyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(C(F)F)nc2sc(C(=O)Nc3cccc([N+](=O)[O-])c3)c(N)c12 |
| InChI | InChI=1S/C16H12F2N4O3S/c1-7-5-10(14(17)18)21-16-11(7)12(19)13(26-16)15(23)20-8-3-2-4-9(6-8)22(24)25/h2-6,14H,19H2,1H3,(H,20,23) |
| InChIKey | WDTFXCQWZFQMQJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|