C17H13FN4O3S — CID 30142383
2-(4-fluoroanilino)-4-methyl-N-(3-nitrophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 30142383) has the molecular formula C17H13FN4O3S and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-4-methyl-N-(3-nitrophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-fluoroanilino)-4-methyl-N-(3-nitrophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 30142383 |
| Molecular Formula | C17H13FN4O3S |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-(4-fluoroanilino)-4-methyl-N-(3-nitrophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Nc2ccc(F)cc2)sc1C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13FN4O3S/c1-10-15(16(23)20-13-3-2-4-14(9-13)22(24)25)26-17(19-10)21-12-7-5-11(18)6-8-12/h2-9H,1H3,(H,19,21)(H,20,23) |
| InChIKey | PUQSNXXBNRVZDT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|