C18H16N4O3S — CID 30141715
4-methyl-2-(N-methylanilino)-N-(3-nitrophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 30141715) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 4-methyl-2-(N-methylanilino)-N-(3-nitrophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-2-(N-methylanilino)-N-(3-nitrophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 30141715 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-methyl-2-(N-methylanilino)-N-(3-nitrophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N(C)c2ccccc2)sc1C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N4O3S/c1-12-16(17(23)20-13-7-6-10-15(11-13)22(24)25)26-18(19-12)21(2)14-8-4-3-5-9-14/h3-11H,1-2H3,(H,20,23) |
| InChIKey | ZBMLLQHCBBTDSB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|