C27H21N3OS — CID 163918979
1-(3-amino-4,6-diphenylthieno[2,3-b]pyridin-2-yl)-2-anilinoethanone (PubChem CID 163918979) has the molecular formula C27H21N3OS and a molecular weight of 435.55 g/mol. Its IUPAC name is 1-(3-amino-4,6-diphenylthieno[2,3-b]pyridin-2-yl)-2-anilinoethanone.
| Compound Name | 1-(3-amino-4,6-diphenylthieno[2,3-b]pyridin-2-yl)-2-anilinoethanone |
|---|---|
| PubChem CID | 163918979 |
| Molecular Formula | C27H21N3OS |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 1-(3-amino-4,6-diphenylthieno[2,3-b]pyridin-2-yl)-2-anilinoethanone |
| SMILES | Nc1c(C(=O)CNc2ccccc2)sc2nc(-c3ccccc3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C27H21N3OS/c28-25-24-21(18-10-4-1-5-11-18)16-22(19-12-6-2-7-13-19)30-27(24)32-26(25)23(31)17-29-20-14-8-3-9-15-20/h1-16,29H,17,28H2 |
| InChIKey | QYTIHTSPLLMTIN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |