C28H22N2O3S — CID 132557187
(4-methylphenyl) 3-amino-4-(4-methoxyphenyl)-6-phenylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 132557187) has the molecular formula C28H22N2O3S and a molecular weight of 466.56 g/mol. Its IUPAC name is (4-methylphenyl) 3-amino-4-(4-methoxyphenyl)-6-phenylthieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | (4-methylphenyl) 3-amino-4-(4-methoxyphenyl)-6-phenylthieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 132557187 |
| Molecular Formula | C28H22N2O3S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | (4-methylphenyl) 3-amino-4-(4-methoxyphenyl)-6-phenylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc3sc(C(=O)Oc4ccc(C)cc4)c(N)c23)cc1 |
| InChI | InChI=1S/C28H22N2O3S/c1-17-8-12-21(13-9-17)33-28(31)26-25(29)24-22(18-10-14-20(32-2)15-11-18)16-23(30-27(24)34-26)19-6-4-3-5-7-19/h3-16H,29H2,1-2H3 |
| InChIKey | XSMURLCRXFVYFR-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|