C22H19N3O3S — CID 984123
3-amino-4,6-bis(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 984123) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 3-amino-4,6-bis(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-4,6-bis(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 984123 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 3-amino-4,6-bis(4-methoxyphenyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3)c3c(N)c(C(N)=O)sc3n2)cc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-27-14-7-3-12(4-8-14)16-11-17(13-5-9-15(28-2)10-6-13)25-22-18(16)19(23)20(29-22)21(24)26/h3-11H,23H2,1-2H3,(H2,24,26) |
| InChIKey | IEWCZXOWTVRCAR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |