C15H11N5OS — CID 3117016
3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 3117016) has the molecular formula C15H11N5OS and a molecular weight of 309.35 g/mol. Its IUPAC name is 3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 3117016 |
| Molecular Formula | C15H11N5OS |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3,6-diamino-5-cyano-4-phenylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | N#Cc1c(N)nc2sc(C(N)=O)c(N)c2c1-c1ccccc1 |
| InChI | InChI=1S/C15H11N5OS/c16-6-8-9(7-4-2-1-3-5-7)10-11(17)12(14(19)21)22-15(10)20-13(8)18/h1-5H,17H2,(H2,18,20)(H2,19,21) |
| InChIKey | TYEHUZZBGBJVKD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 131.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |