C19H15N8O5S+ — CID 53295933
3,6-diamino-5-cyano-N-(2-methyl-5-nitrophenyl)-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 53295933) has the molecular formula C19H15N8O5S+ and a molecular weight of 467.45 g/mol. Its IUPAC name is 3,6-diamino-5-cyano-N-(2-methyl-5-nitrophenyl)-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3,6-diamino-5-cyano-N-(2-methyl-5-nitrophenyl)-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 53295933 |
| Molecular Formula | C19H15N8O5S+ |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 3,6-diamino-5-cyano-N-(2-methyl-5-nitrophenyl)-4-(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)c1sc2nc(N)c(C#N)c(-c3c(=O)o[nH][n+]3C)c2c1N |
| InChI | InChI=1S/C19H14N8O5S/c1-7-3-4-8(27(30)31)5-10(7)23-17(28)15-13(21)12-11(14-19(29)32-25-26(14)2)9(6-20)16(22)24-18(12)33-15/h3-5H,1-2H3,(H5-,21,22,23,24,25,28,29)/p+1 |
| InChIKey | RUUZDJIFNMDSCL-UHFFFAOYSA-O |
| XLogP | 1.57 |
| TPSA | 210.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|