C17H15N4O5S- — CID 7030010
2-[[3-amino-4-(methoxymethyl)-6-methylthieno[2,3-b]pyridine-2-carbonyl]amino]-4-nitrophenolate (PubChem CID 7030010) has the molecular formula C17H15N4O5S- and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-[[3-amino-4-(methoxymethyl)-6-methylthieno[2,3-b]pyridine-2-carbonyl]amino]-4-nitrophenolate.
| Compound Name | 2-[[3-amino-4-(methoxymethyl)-6-methylthieno[2,3-b]pyridine-2-carbonyl]amino]-4-nitrophenolate |
|---|---|
| PubChem CID | 7030010 |
| Molecular Formula | C17H15N4O5S- |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-[[3-amino-4-(methoxymethyl)-6-methylthieno[2,3-b]pyridine-2-carbonyl]amino]-4-nitrophenolate |
| SMILES | COCc1cc(C)nc2sc(C(=O)Nc3cc([N+](=O)[O-])ccc3[O-])c(N)c12 |
| InChI | InChI=1S/C17H16N4O5S/c1-8-5-9(7-26-2)13-14(18)15(27-17(13)19-8)16(23)20-11-6-10(21(24)25)3-4-12(11)22/h3-6,22H,7,18H2,1-2H3,(H,20,23)/p-1 |
| InChIKey | ZRKWUBZDYVOZMY-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 143.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|